2014-04-02 00:11:14 +05:30
|
|
|
# -*- coding: UTF-8 no BOM -*-
|
|
|
|
|
2015-04-03 00:45:09 +05:30
|
|
|
###################################################
|
2015-05-08 19:44:44 +05:30
|
|
|
# NOTE: everything here needs to be a np array #
|
2015-04-03 00:45:09 +05:30
|
|
|
###################################################
|
|
|
|
|
2015-05-08 19:44:44 +05:30
|
|
|
import math,random
|
|
|
|
import numpy as np
|
2011-11-03 17:49:26 +05:30
|
|
|
|
|
|
|
# ******************************************************************************************
|
2013-11-26 00:34:39 +05:30
|
|
|
class Rodrigues:
|
2011-11-03 17:49:26 +05:30
|
|
|
# ******************************************************************************************
|
|
|
|
|
2015-05-08 19:44:44 +05:30
|
|
|
def __init__(self, vector = np.zeros(3)):
|
2013-11-26 00:34:39 +05:30
|
|
|
self.vector = vector
|
2015-04-03 00:45:09 +05:30
|
|
|
|
2013-11-26 00:34:39 +05:30
|
|
|
def asQuaternion(self):
|
2015-05-08 19:44:44 +05:30
|
|
|
norm = np.linalg.norm(self.vector)
|
|
|
|
halfAngle = np.arctan(norm)
|
|
|
|
return Quaternion(np.cos(halfAngle),np.sin(halfAngle)*self.vector/norm)
|
2011-11-03 17:49:26 +05:30
|
|
|
|
2013-11-26 00:34:39 +05:30
|
|
|
def asAngleAxis(self):
|
2015-05-08 19:44:44 +05:30
|
|
|
norm = np.linalg.norm(self.vector)
|
|
|
|
halfAngle = np.arctan(norm)
|
2013-11-26 00:34:39 +05:30
|
|
|
return (2.0*halfAngle,self.vector/norm)
|
2011-11-03 17:49:26 +05:30
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
# ******************************************************************************************
|
|
|
|
class Quaternion:
|
|
|
|
# ******************************************************************************************
|
2015-04-03 00:45:09 +05:30
|
|
|
# All methods and naming conventions based off
|
2011-11-03 17:49:26 +05:30
|
|
|
# http://www.euclideanspace.com/maths/algebra/realNormedAlgebra/quaternions
|
|
|
|
|
|
|
|
# w is the real part, (x, y, z) are the imaginary parts
|
|
|
|
|
|
|
|
def __init__(self, quatArray=[1.0,0.0,0.0,0.0]):
|
2013-11-26 00:34:39 +05:30
|
|
|
self.w, \
|
|
|
|
self.x, \
|
|
|
|
self.y, \
|
|
|
|
self.z = quatArray
|
|
|
|
self = self.homomorph()
|
2011-11-03 17:49:26 +05:30
|
|
|
|
|
|
|
def __iter__(self):
|
2013-11-26 00:34:39 +05:30
|
|
|
return iter([self.w,self.x,self.y,self.z])
|
|
|
|
|
2011-11-03 17:49:26 +05:30
|
|
|
def __copy__(self):
|
2013-11-26 00:34:39 +05:30
|
|
|
Q = Quaternion([self.w,self.x,self.y,self.z])
|
|
|
|
return Q
|
2011-11-03 17:49:26 +05:30
|
|
|
|
|
|
|
copy = __copy__
|
|
|
|
|
|
|
|
def __repr__(self):
|
2013-11-26 00:34:39 +05:30
|
|
|
return 'Quaternion(real=%+.4f, imag=<%+.4f, %+.4f, %+.4f>)' % \
|
|
|
|
(self.w, self.x, self.y, self.z)
|
2011-11-03 17:49:26 +05:30
|
|
|
|
2014-08-22 21:15:03 +05:30
|
|
|
def __pow__(self, exponent):
|
|
|
|
omega = math.acos(self.w)
|
|
|
|
vRescale = math.sin(exponent*omega)/math.sin(omega)
|
|
|
|
Q = Quaternion()
|
|
|
|
Q.x = self.x * vRescale
|
|
|
|
Q.y = self.y * vRescale
|
|
|
|
Q.z = self.z * vRescale
|
|
|
|
Q.w = math.cos(exponent*omega)
|
|
|
|
return Q
|
2015-04-03 00:45:09 +05:30
|
|
|
|
2014-08-22 21:15:03 +05:30
|
|
|
def __ipow__(self, exponent):
|
|
|
|
omega = math.acos(self.w)
|
|
|
|
vRescale = math.sin(exponent*omega)/math.sin(omega)
|
|
|
|
self.x *= vRescale
|
|
|
|
self.y *= vRescale
|
|
|
|
self.z *= vRescale
|
2015-05-08 19:44:44 +05:30
|
|
|
self.w = np.cos(exponent*omega)
|
2014-08-22 21:15:03 +05:30
|
|
|
return self
|
2015-04-03 00:45:09 +05:30
|
|
|
|
2011-11-03 17:49:26 +05:30
|
|
|
def __mul__(self, other):
|
2013-12-09 21:19:57 +05:30
|
|
|
try: # quaternion
|
2013-11-26 00:34:39 +05:30
|
|
|
Ax = self.x
|
|
|
|
Ay = self.y
|
|
|
|
Az = self.z
|
|
|
|
Aw = self.w
|
|
|
|
Bx = other.x
|
|
|
|
By = other.y
|
|
|
|
Bz = other.z
|
|
|
|
Bw = other.w
|
|
|
|
Q = Quaternion()
|
2013-12-09 21:19:57 +05:30
|
|
|
Q.x = + Ax * Bw + Ay * Bz - Az * By + Aw * Bx
|
2013-11-26 00:34:39 +05:30
|
|
|
Q.y = - Ax * Bz + Ay * Bw + Az * Bx + Aw * By
|
|
|
|
Q.z = + Ax * By - Ay * Bx + Az * Bw + Aw * Bz
|
|
|
|
Q.w = - Ax * Bx - Ay * By - Az * Bz + Aw * Bw
|
|
|
|
return Q
|
2013-12-09 21:19:57 +05:30
|
|
|
except: pass
|
|
|
|
try: # vector (perform active rotation, i.e. q*v*q.conjugated)
|
2013-11-26 00:34:39 +05:30
|
|
|
w = self.w
|
|
|
|
x = self.x
|
|
|
|
y = self.y
|
|
|
|
z = self.z
|
|
|
|
Vx = other[0]
|
|
|
|
Vy = other[1]
|
|
|
|
Vz = other[2]
|
|
|
|
|
2015-05-08 19:44:44 +05:30
|
|
|
return np.array([\
|
2013-11-26 00:34:39 +05:30
|
|
|
w * w * Vx + 2 * y * w * Vz - 2 * z * w * Vy + \
|
|
|
|
x * x * Vx + 2 * y * x * Vy + 2 * z * x * Vz - \
|
|
|
|
z * z * Vx - y * y * Vx,
|
|
|
|
2 * x * y * Vx + y * y * Vy + 2 * z * y * Vz + \
|
|
|
|
2 * w * z * Vx - z * z * Vy + w * w * Vy - \
|
|
|
|
2 * x * w * Vz - x * x * Vy,
|
|
|
|
2 * x * z * Vx + 2 * y * z * Vy + \
|
|
|
|
z * z * Vz - 2 * w * y * Vx - y * y * Vz + \
|
|
|
|
2 * w * x * Vy - x * x * Vz + w * w * Vz ])
|
2013-12-09 21:19:57 +05:30
|
|
|
except: pass
|
|
|
|
try: # scalar
|
2013-11-26 00:34:39 +05:30
|
|
|
Q = self.copy()
|
|
|
|
Q.w *= other
|
|
|
|
Q.x *= other
|
|
|
|
Q.y *= other
|
|
|
|
Q.z *= other
|
|
|
|
return Q
|
2013-12-09 21:19:57 +05:30
|
|
|
except:
|
2013-11-26 00:34:39 +05:30
|
|
|
return self.copy()
|
2011-11-03 17:49:26 +05:30
|
|
|
|
|
|
|
def __imul__(self, other):
|
2014-08-22 21:15:03 +05:30
|
|
|
try: # Quaternion
|
2013-11-26 00:34:39 +05:30
|
|
|
Ax = self.x
|
|
|
|
Ay = self.y
|
|
|
|
Az = self.z
|
|
|
|
Aw = self.w
|
|
|
|
Bx = other.x
|
|
|
|
By = other.y
|
|
|
|
Bz = other.z
|
|
|
|
Bw = other.w
|
2015-04-03 00:45:09 +05:30
|
|
|
self.x = Ax * Bw + Ay * Bz - Az * By + Aw * Bx
|
2013-11-26 00:34:39 +05:30
|
|
|
self.y = -Ax * Bz + Ay * Bw + Az * Bx + Aw * By
|
|
|
|
self.z = Ax * By - Ay * Bx + Az * Bw + Aw * Bz
|
|
|
|
self.w = -Ax * Bx - Ay * By - Az * Bz + Aw * Bw
|
2013-12-09 21:19:57 +05:30
|
|
|
except: pass
|
2013-11-26 00:34:39 +05:30
|
|
|
return self
|
2015-04-03 00:45:09 +05:30
|
|
|
|
2011-11-03 17:49:26 +05:30
|
|
|
def __div__(self, other):
|
2013-11-26 00:34:39 +05:30
|
|
|
if isinstance(other, (int,float,long)):
|
|
|
|
w = self.w / other
|
|
|
|
x = self.x / other
|
|
|
|
y = self.y / other
|
|
|
|
z = self.z / other
|
|
|
|
return self.__class__([w,x,y,z])
|
|
|
|
else:
|
|
|
|
return NotImplemented
|
2011-11-03 17:49:26 +05:30
|
|
|
|
|
|
|
def __idiv__(self, other):
|
2013-11-26 00:34:39 +05:30
|
|
|
if isinstance(other, (int,float,long)):
|
|
|
|
self.w /= other
|
|
|
|
self.x /= other
|
|
|
|
self.y /= other
|
|
|
|
self.z /= other
|
|
|
|
return self
|
2011-11-03 17:49:26 +05:30
|
|
|
|
|
|
|
def __add__(self, other):
|
2013-11-26 00:34:39 +05:30
|
|
|
if isinstance(other, Quaternion):
|
|
|
|
w = self.w + other.w
|
|
|
|
x = self.x + other.x
|
|
|
|
y = self.y + other.y
|
|
|
|
z = self.z + other.z
|
|
|
|
return self.__class__([w,x,y,z])
|
|
|
|
else:
|
|
|
|
return NotImplemented
|
2011-11-03 17:49:26 +05:30
|
|
|
|
|
|
|
def __iadd__(self, other):
|
2013-11-26 00:34:39 +05:30
|
|
|
if isinstance(other, Quaternion):
|
|
|
|
self.w += other.w
|
|
|
|
self.x += other.x
|
|
|
|
self.y += other.y
|
|
|
|
self.z += other.z
|
|
|
|
return self
|
2011-11-03 17:49:26 +05:30
|
|
|
|
|
|
|
def __sub__(self, other):
|
2013-11-26 00:34:39 +05:30
|
|
|
if isinstance(other, Quaternion):
|
|
|
|
Q = self.copy()
|
|
|
|
Q.w -= other.w
|
|
|
|
Q.x -= other.x
|
|
|
|
Q.y -= other.y
|
|
|
|
Q.z -= other.z
|
|
|
|
return Q
|
|
|
|
else:
|
|
|
|
return self.copy()
|
2011-11-03 17:49:26 +05:30
|
|
|
|
|
|
|
def __isub__(self, other):
|
2013-11-26 00:34:39 +05:30
|
|
|
if isinstance(other, Quaternion):
|
|
|
|
self.w -= other.w
|
|
|
|
self.x -= other.x
|
|
|
|
self.y -= other.y
|
|
|
|
self.z -= other.z
|
|
|
|
return self
|
2011-11-03 17:49:26 +05:30
|
|
|
|
|
|
|
def __neg__(self):
|
2013-11-26 00:34:39 +05:30
|
|
|
self.w = -self.w
|
|
|
|
self.x = -self.x
|
|
|
|
self.y = -self.y
|
|
|
|
self.z = -self.z
|
|
|
|
return self
|
2011-11-03 17:49:26 +05:30
|
|
|
|
|
|
|
def __abs__(self):
|
2013-11-26 00:34:39 +05:30
|
|
|
return math.sqrt(self.w ** 2 + \
|
|
|
|
self.x ** 2 + \
|
|
|
|
self.y ** 2 + \
|
|
|
|
self.z ** 2)
|
2011-11-03 17:49:26 +05:30
|
|
|
|
|
|
|
magnitude = __abs__
|
|
|
|
|
|
|
|
def __eq__(self,other):
|
2013-11-26 00:34:39 +05:30
|
|
|
return (abs(self.w-other.w) < 1e-8 and \
|
|
|
|
abs(self.x-other.x) < 1e-8 and \
|
|
|
|
abs(self.y-other.y) < 1e-8 and \
|
|
|
|
abs(self.z-other.z) < 1e-8) \
|
|
|
|
or \
|
|
|
|
(abs(-self.w-other.w) < 1e-8 and \
|
|
|
|
abs(-self.x-other.x) < 1e-8 and \
|
|
|
|
abs(-self.y-other.y) < 1e-8 and \
|
2015-04-03 00:45:09 +05:30
|
|
|
abs(-self.z-other.z) < 1e-8)
|
2011-11-03 17:49:26 +05:30
|
|
|
|
|
|
|
def __ne__(self,other):
|
2013-11-26 00:34:39 +05:30
|
|
|
return not __eq__(self,other)
|
2011-11-03 17:49:26 +05:30
|
|
|
|
|
|
|
def __cmp__(self,other):
|
2013-11-26 00:34:39 +05:30
|
|
|
return cmp(self.Rodrigues(),other.Rodrigues())
|
2011-11-03 17:49:26 +05:30
|
|
|
|
|
|
|
def magnitude_squared(self):
|
2013-11-26 00:34:39 +05:30
|
|
|
return self.w ** 2 + \
|
|
|
|
self.x ** 2 + \
|
|
|
|
self.y ** 2 + \
|
2015-04-03 00:45:09 +05:30
|
|
|
self.z ** 2
|
2011-11-03 17:49:26 +05:30
|
|
|
|
|
|
|
def identity(self):
|
2013-11-26 00:34:39 +05:30
|
|
|
self.w = 1.
|
|
|
|
self.x = 0.
|
|
|
|
self.y = 0.
|
|
|
|
self.z = 0.
|
|
|
|
return self
|
2011-11-03 17:49:26 +05:30
|
|
|
|
|
|
|
def rotateBy_angleaxis(self, angle, axis):
|
2013-11-26 00:34:39 +05:30
|
|
|
self *= Quaternion.fromAngleAxis(angle, axis)
|
|
|
|
return self
|
2011-11-03 17:49:26 +05:30
|
|
|
|
|
|
|
def rotateBy_Eulers(self, heading, attitude, bank):
|
2013-11-26 00:34:39 +05:30
|
|
|
self *= Quaternion.fromEulers(eulers, type)
|
|
|
|
return self
|
2011-11-03 17:49:26 +05:30
|
|
|
|
|
|
|
def rotateBy_matrix(self, m):
|
2013-11-26 00:34:39 +05:30
|
|
|
self *= Quaternion.fromMatrix(m)
|
|
|
|
return self
|
2011-11-03 17:49:26 +05:30
|
|
|
|
|
|
|
def normalize(self):
|
2013-11-26 00:34:39 +05:30
|
|
|
d = self.magnitude()
|
|
|
|
if d > 0.0:
|
|
|
|
self /= d
|
|
|
|
return self
|
2011-11-03 17:49:26 +05:30
|
|
|
|
|
|
|
def conjugate(self):
|
2013-11-26 00:34:39 +05:30
|
|
|
self.x = -self.x
|
|
|
|
self.y = -self.y
|
|
|
|
self.z = -self.z
|
|
|
|
return self
|
|
|
|
|
|
|
|
def inverse(self):
|
|
|
|
d = self.magnitude()
|
|
|
|
if d > 0.0:
|
|
|
|
self.conjugate()
|
|
|
|
self /= d
|
|
|
|
return self
|
|
|
|
|
|
|
|
def homomorph(self):
|
|
|
|
if self.w < 0.0:
|
|
|
|
self.w = -self.w
|
2011-11-03 17:49:26 +05:30
|
|
|
self.x = -self.x
|
|
|
|
self.y = -self.y
|
|
|
|
self.z = -self.z
|
2013-11-26 00:34:39 +05:30
|
|
|
return self
|
2011-11-03 17:49:26 +05:30
|
|
|
|
|
|
|
def normalized(self):
|
2013-11-26 00:34:39 +05:30
|
|
|
return self.copy().normalize()
|
2011-11-03 17:49:26 +05:30
|
|
|
|
|
|
|
def conjugated(self):
|
2013-11-26 00:34:39 +05:30
|
|
|
return self.copy().conjugate()
|
2011-11-03 17:49:26 +05:30
|
|
|
|
|
|
|
def inversed(self):
|
2013-11-26 00:34:39 +05:30
|
|
|
return self.copy().inverse()
|
2011-11-03 17:49:26 +05:30
|
|
|
|
2013-11-26 00:34:39 +05:30
|
|
|
def homomorphed(self):
|
|
|
|
return self.copy().homomorph()
|
2011-11-03 17:49:26 +05:30
|
|
|
|
2013-11-26 00:34:39 +05:30
|
|
|
def asList(self):
|
|
|
|
return [i for i in self]
|
|
|
|
|
2014-08-22 21:15:03 +05:30
|
|
|
def asM(self): # to find Averaging Quaternions (see F. Landis Markley et al.)
|
2015-05-08 19:44:44 +05:30
|
|
|
return np.outer([i for i in self],[i for i in self])
|
2014-08-22 21:15:03 +05:30
|
|
|
|
2013-11-26 00:34:39 +05:30
|
|
|
def asMatrix(self):
|
2015-05-08 19:44:44 +05:30
|
|
|
return np.array([[1.0-2.0*(self.y*self.y+self.z*self.z), 2.0*(self.x*self.y-self.z*self.w), 2.0*(self.x*self.z+self.y*self.w)],
|
|
|
|
[ 2.0*(self.x*self.y+self.z*self.w), 1.0-2.0*(self.x*self.x+self.z*self.z), 2.0*(self.y*self.z-self.x*self.w)],
|
|
|
|
[ 2.0*(self.x*self.z-self.y*self.w), 2.0*(self.x*self.w+self.y*self.z), 1.0-2.0*(self.x*self.x+self.y*self.y)]])
|
2015-04-03 00:45:09 +05:30
|
|
|
|
2013-11-26 00:34:39 +05:30
|
|
|
def asAngleAxis(self):
|
|
|
|
if self.w > 1:
|
|
|
|
self.normalize()
|
2015-03-06 19:24:30 +05:30
|
|
|
|
|
|
|
s = math.sqrt(1. - self.w**2)
|
|
|
|
x = 2*self.w**2 - 1.
|
|
|
|
y = 2*self.w * s
|
2015-04-03 00:45:09 +05:30
|
|
|
|
2015-03-06 19:24:30 +05:30
|
|
|
angle = math.atan2(y,x)
|
2015-04-03 00:45:09 +05:30
|
|
|
|
2015-03-06 19:24:30 +05:30
|
|
|
if angle < 1e-3:
|
2015-05-08 19:44:44 +05:30
|
|
|
return angle, np.array([1.0, 0.0, 0.0])
|
2013-11-26 00:34:39 +05:30
|
|
|
else:
|
2015-05-08 19:44:44 +05:30
|
|
|
return angle, np.array([self.x / s, self.y / s, self.z / s])
|
2013-11-26 00:34:39 +05:30
|
|
|
|
|
|
|
def asRodrigues(self):
|
|
|
|
if self.w != 0.0:
|
2015-05-08 19:44:44 +05:30
|
|
|
return np.array([self.x, self.y, self.z])/self.w
|
2013-11-26 00:34:39 +05:30
|
|
|
else:
|
2015-05-08 19:44:44 +05:30
|
|
|
return np.array([float('inf')]*3)
|
2013-11-26 00:34:39 +05:30
|
|
|
|
|
|
|
def asEulers(self,type='bunge'):
|
2015-03-06 19:24:30 +05:30
|
|
|
'''
|
|
|
|
conversion taken from:
|
|
|
|
Melcher, A.; Unser, A.; Reichhardt, M.; Nestler, B.; Pötschke, M.; Selzer, M.
|
|
|
|
Conversion of EBSD data by a quaternion based algorithm to be used for grain structure simulations
|
|
|
|
Technische Mechanik 30 (2010) pp 401--413
|
|
|
|
'''
|
2013-11-26 00:34:39 +05:30
|
|
|
angles = [0.0,0.0,0.0]
|
2015-03-06 19:24:30 +05:30
|
|
|
|
2013-11-26 00:34:39 +05:30
|
|
|
if type.lower() == 'bunge' or type.lower() == 'zxz':
|
2015-03-06 19:24:30 +05:30
|
|
|
if abs(self.x - self.y) < 1e-8:
|
|
|
|
x = self.w**2 - self.z**2
|
|
|
|
y = 2.*self.w*self.z
|
|
|
|
angles[0] = math.atan2(y,x)
|
|
|
|
elif abs(self.w - self.z) < 1e-8:
|
|
|
|
x = self.x**2 - self.y**2
|
|
|
|
y = 2.*self.x*self.y
|
|
|
|
angles[0] = math.atan2(y,x)
|
|
|
|
angles[1] = math.pi
|
|
|
|
else:
|
|
|
|
chi = math.sqrt((self.w**2 + self.z**2)*(self.x**2 + self.y**2))
|
|
|
|
|
|
|
|
x = (self.w * self.x - self.y * self.z)/2./chi
|
|
|
|
y = (self.w * self.y + self.x * self.z)/2./chi
|
|
|
|
angles[0] = math.atan2(y,x)
|
|
|
|
|
|
|
|
x = self.w**2 + self.z**2 - (self.x**2 + self.y**2)
|
|
|
|
y = 2.*chi
|
|
|
|
angles[1] = math.atan2(y,x)
|
|
|
|
|
|
|
|
x = (self.w * self.x + self.y * self.z)/2./chi
|
|
|
|
y = (self.z * self.x - self.y * self.w)/2./chi
|
|
|
|
angles[2] = math.atan2(y,x)
|
|
|
|
|
|
|
|
# if angles[0] < 0.0:
|
|
|
|
# angles[0] += 2*math.pi
|
|
|
|
# if angles[1] < 0.0:
|
|
|
|
# angles[1] += math.pi
|
|
|
|
# angles[2] *= -1
|
|
|
|
# if angles[2] < 0.0:
|
|
|
|
# angles[2] += 2*math.pi
|
2015-04-03 00:45:09 +05:30
|
|
|
|
2013-11-26 00:34:39 +05:30
|
|
|
return angles
|
|
|
|
|
2011-11-03 17:49:26 +05:30
|
|
|
|
|
|
|
# # Static constructors
|
2013-11-26 00:34:39 +05:30
|
|
|
@classmethod
|
|
|
|
def fromIdentity(cls):
|
2011-11-03 17:49:26 +05:30
|
|
|
return cls()
|
|
|
|
|
2013-11-26 00:34:39 +05:30
|
|
|
|
|
|
|
@classmethod
|
|
|
|
def fromRandom(cls):
|
2011-11-03 17:49:26 +05:30
|
|
|
r1 = random.random()
|
|
|
|
r2 = random.random()
|
|
|
|
r3 = random.random()
|
2013-11-26 00:34:39 +05:30
|
|
|
w = math.cos(2.0*math.pi*r1)*math.sqrt(r3)
|
|
|
|
x = math.sin(2.0*math.pi*r2)*math.sqrt(1.0-r3)
|
|
|
|
y = math.cos(2.0*math.pi*r2)*math.sqrt(1.0-r3)
|
|
|
|
z = math.sin(2.0*math.pi*r1)*math.sqrt(r3)
|
|
|
|
return cls([w,x,y,z])
|
|
|
|
|
2011-11-03 17:49:26 +05:30
|
|
|
|
2013-11-26 00:34:39 +05:30
|
|
|
@classmethod
|
|
|
|
def fromRodrigues(cls, rodrigues):
|
2015-05-08 19:44:44 +05:30
|
|
|
if not isinstance(rodrigues, np.ndarray): rodrigues = np.array(rodrigues)
|
|
|
|
halfangle = math.atan(np.linalg.norm(rodrigues))
|
2011-11-03 17:49:26 +05:30
|
|
|
c = math.cos(halfangle)
|
2013-11-26 00:34:39 +05:30
|
|
|
w = c
|
|
|
|
x,y,z = c*rodrigues
|
|
|
|
return cls([w,x,y,z])
|
|
|
|
|
2011-11-03 17:49:26 +05:30
|
|
|
|
2013-11-26 00:34:39 +05:30
|
|
|
@classmethod
|
|
|
|
def fromAngleAxis(cls, angle, axis):
|
2015-05-08 19:44:44 +05:30
|
|
|
if not isinstance(axis, np.ndarray): axis = np.array(axis)
|
|
|
|
axis /= np.linalg.norm(axis)
|
2013-12-09 21:19:57 +05:30
|
|
|
s = math.sin(angle / 2.0)
|
|
|
|
w = math.cos(angle / 2.0)
|
2013-11-26 00:34:39 +05:30
|
|
|
x = axis[0] * s
|
|
|
|
y = axis[1] * s
|
|
|
|
z = axis[2] * s
|
|
|
|
return cls([w,x,y,z])
|
|
|
|
|
2011-11-03 17:49:26 +05:30
|
|
|
|
2013-11-26 00:34:39 +05:30
|
|
|
@classmethod
|
|
|
|
def fromEulers(cls, eulers, type = 'Bunge'):
|
2011-11-03 17:49:26 +05:30
|
|
|
c1 = math.cos(eulers[0] / 2.0)
|
|
|
|
s1 = math.sin(eulers[0] / 2.0)
|
|
|
|
c2 = math.cos(eulers[1] / 2.0)
|
|
|
|
s2 = math.sin(eulers[1] / 2.0)
|
|
|
|
c3 = math.cos(eulers[2] / 2.0)
|
|
|
|
s3 = math.sin(eulers[2] / 2.0)
|
|
|
|
|
|
|
|
if type.lower() == 'bunge' or type.lower() == 'zxz':
|
2013-11-26 00:34:39 +05:30
|
|
|
w = c1 * c2 * c3 - s1 * c2 * s3
|
|
|
|
x = c1 * s2 * c3 + s1 * s2 * s3
|
|
|
|
y = - c1 * s2 * s3 + s1 * s2 * c3
|
|
|
|
z = c1 * c2 * s3 + s1 * c2 * c3
|
2011-11-03 17:49:26 +05:30
|
|
|
else:
|
2015-03-06 20:43:18 +05:30
|
|
|
# print 'unknown Euler convention'
|
2013-11-26 00:34:39 +05:30
|
|
|
w = c1 * c2 * c3 - s1 * s2 * s3
|
|
|
|
x = s1 * s2 * c3 + c1 * c2 * s3
|
|
|
|
y = s1 * c2 * c3 + c1 * s2 * s3
|
|
|
|
z = c1 * s2 * c3 - s1 * c2 * s3
|
|
|
|
return cls([w,x,y,z])
|
|
|
|
|
|
|
|
|
|
|
|
@classmethod
|
|
|
|
def fromMatrix(cls, m):
|
|
|
|
if m[0,0] + m[1,1] + m[2,2] > 0.00000001:
|
|
|
|
t = m[0,0] + m[1,1] + m[2,2] + 1.0
|
2011-11-03 17:49:26 +05:30
|
|
|
s = 0.5/math.sqrt(t)
|
2013-11-26 00:34:39 +05:30
|
|
|
|
2011-11-03 17:49:26 +05:30
|
|
|
return cls(
|
2013-11-26 00:34:39 +05:30
|
|
|
[ s*t,
|
|
|
|
(m[1,2] - m[2,1])*s,
|
|
|
|
(m[2,0] - m[0,2])*s,
|
|
|
|
(m[0,1] - m[1,0])*s,
|
|
|
|
])
|
2015-04-03 00:45:09 +05:30
|
|
|
|
2013-11-26 00:34:39 +05:30
|
|
|
elif m[0,0] > m[1,1] and m[0,0] > m[2,2]:
|
|
|
|
t = m[0,0] - m[1,1] - m[2,2] + 1.0
|
2011-11-03 17:49:26 +05:30
|
|
|
s = 0.5/math.sqrt(t)
|
2015-04-03 00:45:09 +05:30
|
|
|
|
2011-11-03 17:49:26 +05:30
|
|
|
return cls(
|
2013-11-26 00:34:39 +05:30
|
|
|
[ (m[1,2] - m[2,1])*s,
|
|
|
|
s*t,
|
|
|
|
(m[0,1] + m[1,0])*s,
|
|
|
|
(m[2,0] + m[0,2])*s,
|
|
|
|
])
|
2015-04-03 00:45:09 +05:30
|
|
|
|
2013-11-26 00:34:39 +05:30
|
|
|
elif m[1,1] > m[2,2]:
|
|
|
|
t = -m[0,0] + m[1,1] - m[2,2] + 1.0
|
2011-11-03 17:49:26 +05:30
|
|
|
s = 0.5/math.sqrt(t)
|
2015-04-03 00:45:09 +05:30
|
|
|
|
2011-11-03 17:49:26 +05:30
|
|
|
return cls(
|
2013-11-26 00:34:39 +05:30
|
|
|
[ (m[2,0] - m[0,2])*s,
|
|
|
|
(m[0,1] + m[1,0])*s,
|
|
|
|
s*t,
|
|
|
|
(m[1,2] + m[2,1])*s,
|
|
|
|
])
|
2015-04-03 00:45:09 +05:30
|
|
|
|
2011-11-03 17:49:26 +05:30
|
|
|
else:
|
2013-11-26 00:34:39 +05:30
|
|
|
t = -m[0,0] - m[1,1] + m[2,2] + 1.0
|
2011-11-03 17:49:26 +05:30
|
|
|
s = 0.5/math.sqrt(t)
|
2015-04-03 00:45:09 +05:30
|
|
|
|
2011-11-03 17:49:26 +05:30
|
|
|
return cls(
|
2013-11-26 00:34:39 +05:30
|
|
|
[ (m[0,1] - m[1,0])*s,
|
|
|
|
(m[2,0] + m[0,2])*s,
|
|
|
|
(m[1,2] + m[2,1])*s,
|
|
|
|
s*t,
|
|
|
|
])
|
2015-04-03 00:45:09 +05:30
|
|
|
|
2013-11-26 00:34:39 +05:30
|
|
|
|
|
|
|
@classmethod
|
2011-11-03 17:49:26 +05:30
|
|
|
def new_interpolate(cls, q1, q2, t):
|
2014-08-22 21:15:03 +05:30
|
|
|
# see http://ntrs.nasa.gov/archive/nasa/casi.ntrs.nasa.gov/20070017872_2007014421.pdf for (another?) way to interpolate quaternions
|
|
|
|
|
2011-11-03 17:49:26 +05:30
|
|
|
assert isinstance(q1, Quaternion) and isinstance(q2, Quaternion)
|
|
|
|
Q = cls()
|
|
|
|
|
|
|
|
costheta = q1.w * q2.w + q1.x * q2.x + q1.y * q2.y + q1.z * q2.z
|
|
|
|
if costheta < 0.:
|
|
|
|
costheta = -costheta
|
|
|
|
q1 = q1.conjugated()
|
|
|
|
elif costheta > 1:
|
|
|
|
costheta = 1
|
|
|
|
|
|
|
|
theta = math.acos(costheta)
|
|
|
|
if abs(theta) < 0.01:
|
|
|
|
Q.w = q2.w
|
|
|
|
Q.x = q2.x
|
|
|
|
Q.y = q2.y
|
|
|
|
Q.z = q2.z
|
|
|
|
return Q
|
|
|
|
|
|
|
|
sintheta = math.sqrt(1.0 - costheta * costheta)
|
|
|
|
if abs(sintheta) < 0.01:
|
|
|
|
Q.w = (q1.w + q2.w) * 0.5
|
|
|
|
Q.x = (q1.x + q2.x) * 0.5
|
|
|
|
Q.y = (q1.y + q2.y) * 0.5
|
|
|
|
Q.z = (q1.z + q2.z) * 0.5
|
|
|
|
return Q
|
|
|
|
|
|
|
|
ratio1 = math.sin((1 - t) * theta) / sintheta
|
|
|
|
ratio2 = math.sin(t * theta) / sintheta
|
|
|
|
|
|
|
|
Q.w = q1.w * ratio1 + q2.w * ratio2
|
|
|
|
Q.x = q1.x * ratio1 + q2.x * ratio2
|
|
|
|
Q.y = q1.y * ratio1 + q2.y * ratio2
|
|
|
|
Q.z = q1.z * ratio1 + q2.z * ratio2
|
|
|
|
return Q
|
2013-11-26 00:34:39 +05:30
|
|
|
|
|
|
|
|
|
|
|
# ******************************************************************************************
|
|
|
|
class Symmetry:
|
|
|
|
# ******************************************************************************************
|
|
|
|
|
|
|
|
lattices = [None,'orthorhombic','tetragonal','hexagonal','cubic',]
|
2015-04-03 00:45:09 +05:30
|
|
|
|
2013-11-26 00:34:39 +05:30
|
|
|
def __init__(self, symmetry = None):
|
|
|
|
if isinstance(symmetry, basestring) and symmetry.lower() in Symmetry.lattices:
|
|
|
|
self.lattice = symmetry.lower()
|
|
|
|
else:
|
|
|
|
self.lattice = None
|
|
|
|
|
|
|
|
|
|
|
|
def __copy__(self):
|
|
|
|
return self.__class__(self.lattice)
|
|
|
|
|
|
|
|
copy = __copy__
|
|
|
|
|
|
|
|
|
|
|
|
def __repr__(self):
|
|
|
|
return '%s' % (self.lattice)
|
|
|
|
|
|
|
|
|
|
|
|
def __eq__(self, other):
|
|
|
|
return self.lattice == other.lattice
|
|
|
|
|
|
|
|
|
|
|
|
def __neq__(self, other):
|
|
|
|
return not self.__eq__(other)
|
|
|
|
|
|
|
|
def __cmp__(self,other):
|
|
|
|
return cmp(Symmetry.lattices.index(self.lattice),Symmetry.lattices.index(other.lattice))
|
|
|
|
|
2013-12-09 21:19:57 +05:30
|
|
|
def equivalentQuaternions(self,quaternion):
|
2013-11-26 00:34:39 +05:30
|
|
|
'''
|
|
|
|
List of symmetrically equivalent quaternions based on own symmetry.
|
|
|
|
'''
|
|
|
|
if self.lattice == 'cubic':
|
|
|
|
symQuats = [
|
|
|
|
[ 1.0,0.0,0.0,0.0 ],
|
|
|
|
[ 0.0,1.0,0.0,0.0 ],
|
|
|
|
[ 0.0,0.0,1.0,0.0 ],
|
|
|
|
[ 0.0,0.0,0.0,1.0 ],
|
|
|
|
[ 0.0, 0.0, 0.5*math.sqrt(2), 0.5*math.sqrt(2) ],
|
|
|
|
[ 0.0, 0.0, 0.5*math.sqrt(2),-0.5*math.sqrt(2) ],
|
|
|
|
[ 0.0, 0.5*math.sqrt(2), 0.0, 0.5*math.sqrt(2) ],
|
|
|
|
[ 0.0, 0.5*math.sqrt(2), 0.0,-0.5*math.sqrt(2) ],
|
|
|
|
[ 0.0, 0.5*math.sqrt(2),-0.5*math.sqrt(2), 0.0 ],
|
|
|
|
[ 0.0,-0.5*math.sqrt(2),-0.5*math.sqrt(2), 0.0 ],
|
|
|
|
[ 0.5, 0.5, 0.5, 0.5 ],
|
|
|
|
[-0.5, 0.5, 0.5, 0.5 ],
|
|
|
|
[-0.5, 0.5, 0.5,-0.5 ],
|
|
|
|
[-0.5, 0.5,-0.5, 0.5 ],
|
|
|
|
[-0.5,-0.5, 0.5, 0.5 ],
|
|
|
|
[-0.5,-0.5, 0.5,-0.5 ],
|
|
|
|
[-0.5,-0.5,-0.5, 0.5 ],
|
|
|
|
[-0.5, 0.5,-0.5,-0.5 ],
|
|
|
|
[-0.5*math.sqrt(2), 0.0, 0.0, 0.5*math.sqrt(2) ],
|
|
|
|
[ 0.5*math.sqrt(2), 0.0, 0.0, 0.5*math.sqrt(2) ],
|
|
|
|
[-0.5*math.sqrt(2), 0.0, 0.5*math.sqrt(2), 0.0 ],
|
|
|
|
[-0.5*math.sqrt(2), 0.0,-0.5*math.sqrt(2), 0.0 ],
|
|
|
|
[-0.5*math.sqrt(2), 0.5*math.sqrt(2), 0.0, 0.0 ],
|
|
|
|
[-0.5*math.sqrt(2),-0.5*math.sqrt(2), 0.0, 0.0 ],
|
|
|
|
]
|
|
|
|
elif self.lattice == 'hexagonal':
|
|
|
|
symQuats = [
|
|
|
|
[ 1.0,0.0,0.0,0.0 ],
|
|
|
|
[ 0.0,1.0,0.0,0.0 ],
|
|
|
|
[ 0.0,0.0,1.0,0.0 ],
|
|
|
|
[ 0.0,0.0,0.0,1.0 ],
|
|
|
|
[-0.5*math.sqrt(3), 0.0, 0.0, 0.5 ],
|
|
|
|
[-0.5*math.sqrt(3), 0.0, 0.0,-0.5 ],
|
|
|
|
[ 0.0, 0.5*math.sqrt(3), 0.5, 0.0 ],
|
|
|
|
[ 0.0,-0.5*math.sqrt(3), 0.5, 0.0 ],
|
|
|
|
[ 0.0, 0.5,-0.5*math.sqrt(3), 0.0 ],
|
|
|
|
[ 0.0,-0.5,-0.5*math.sqrt(3), 0.0 ],
|
|
|
|
[ 0.5, 0.0, 0.0, 0.5*math.sqrt(3) ],
|
|
|
|
[-0.5, 0.0, 0.0, 0.5*math.sqrt(3) ],
|
|
|
|
]
|
|
|
|
elif self.lattice == 'tetragonal':
|
|
|
|
symQuats = [
|
|
|
|
[ 1.0,0.0,0.0,0.0 ],
|
|
|
|
[ 0.0,1.0,0.0,0.0 ],
|
|
|
|
[ 0.0,0.0,1.0,0.0 ],
|
|
|
|
[ 0.0,0.0,0.0,1.0 ],
|
|
|
|
[ 0.0, 0.5*math.sqrt(2), 0.5*math.sqrt(2), 0.0 ],
|
|
|
|
[ 0.0,-0.5*math.sqrt(2), 0.5*math.sqrt(2), 0.0 ],
|
|
|
|
[ 0.5*math.sqrt(2), 0.0, 0.0, 0.5*math.sqrt(2) ],
|
|
|
|
[-0.5*math.sqrt(2), 0.0, 0.0, 0.5*math.sqrt(2) ],
|
|
|
|
]
|
|
|
|
elif self.lattice == 'orthorhombic':
|
|
|
|
symQuats = [
|
|
|
|
[ 1.0,0.0,0.0,0.0 ],
|
|
|
|
[ 0.0,1.0,0.0,0.0 ],
|
|
|
|
[ 0.0,0.0,1.0,0.0 ],
|
|
|
|
[ 0.0,0.0,0.0,1.0 ],
|
|
|
|
]
|
|
|
|
else:
|
|
|
|
symQuats = [
|
|
|
|
[ 1.0,0.0,0.0,0.0 ],
|
|
|
|
]
|
|
|
|
|
2013-12-09 21:19:57 +05:30
|
|
|
return [quaternion*Quaternion(q) for q in symQuats]
|
2013-11-26 00:34:39 +05:30
|
|
|
|
|
|
|
|
|
|
|
def inFZ(self,R):
|
|
|
|
'''
|
|
|
|
Check whether given Rodrigues vector falls into fundamental zone of own symmetry.
|
|
|
|
'''
|
|
|
|
if isinstance(R, Quaternion): R = R.asRodrigues() # translate accidentially passed quaternion
|
|
|
|
R = abs(R) # fundamental zone in Rodrigues space is point symmetric around origin
|
|
|
|
if self.lattice == 'cubic':
|
|
|
|
return math.sqrt(2.0)-1.0 >= R[0] \
|
|
|
|
and math.sqrt(2.0)-1.0 >= R[1] \
|
|
|
|
and math.sqrt(2.0)-1.0 >= R[2] \
|
|
|
|
and 1.0 >= R[0] + R[1] + R[2]
|
|
|
|
elif self.lattice == 'hexagonal':
|
|
|
|
return 1.0 >= R[0] and 1.0 >= R[1] and 1.0 >= R[2] \
|
|
|
|
and 2.0 >= math.sqrt(3)*R[0] + R[1] \
|
|
|
|
and 2.0 >= math.sqrt(3)*R[1] + R[0] \
|
|
|
|
and 2.0 >= math.sqrt(3) + R[2]
|
|
|
|
elif self.lattice == 'tetragonal':
|
|
|
|
return 1.0 >= R[0] and 1.0 >= R[1] \
|
|
|
|
and math.sqrt(2.0) >= R[0] + R[1] \
|
|
|
|
and math.sqrt(2.0) >= R[2] + 1.0
|
2015-04-03 00:45:09 +05:30
|
|
|
elif self.lattice == 'orthorhombic':
|
2013-11-26 00:34:39 +05:30
|
|
|
return 1.0 >= R[0] and 1.0 >= R[1] and 1.0 >= R[2]
|
|
|
|
else:
|
|
|
|
return True
|
|
|
|
|
|
|
|
|
|
|
|
def inDisorientationSST(self,R):
|
|
|
|
'''
|
|
|
|
Check whether given Rodrigues vector (of misorientation) falls into standard stereographic triangle of own symmetry.
|
|
|
|
Determination of disorientations follow the work of A. Heinz and P. Neumann:
|
|
|
|
Representation of Orientation and Disorientation Data for Cubic, Hexagonal, Tetragonal and Orthorhombic Crystals
|
|
|
|
Acta Cryst. (1991). A47, 780-789
|
|
|
|
'''
|
|
|
|
if isinstance(R, Quaternion): R = R.asRodrigues() # translate accidentially passed quaternion
|
|
|
|
|
|
|
|
epsilon = 0.0
|
2015-04-03 00:45:09 +05:30
|
|
|
|
2013-11-26 00:34:39 +05:30
|
|
|
if self.lattice == 'cubic':
|
|
|
|
return R[0] >= R[1]+epsilon and R[1] >= R[2]+epsilon and R[2] >= epsilon and self.inFZ(R)
|
|
|
|
|
|
|
|
elif self.lattice == 'hexagonal':
|
|
|
|
return R[0] >= math.sqrt(3)*(R[1]+epsilon) and R[1] >= epsilon and R[2] >= epsilon and self.inFZ(R)
|
|
|
|
|
|
|
|
elif self.lattice == 'tetragonal':
|
|
|
|
return R[0] >= R[1]+epsilon and R[1] >= epsilon and R[2] >= epsilon and self.inFZ(R)
|
|
|
|
|
|
|
|
elif self.lattice == 'orthorhombic':
|
|
|
|
return R[0] >= epsilon and R[1] >= epsilon and R[2] >= epsilon and self.inFZ(R)
|
|
|
|
|
|
|
|
else:
|
|
|
|
return True
|
|
|
|
|
|
|
|
|
|
|
|
def inSST(self,vector,color = False):
|
|
|
|
'''
|
|
|
|
Check whether given vector falls into standard stereographic triangle of own symmetry.
|
|
|
|
Return inverse pole figure color if requested.
|
|
|
|
'''
|
2015-05-08 19:44:44 +05:30
|
|
|
# basis = {'cubic' : np.linalg.inv(np.array([[0.,0.,1.], # direction of red
|
|
|
|
# [1.,0.,1.]/np.sqrt(2.), # direction of green
|
|
|
|
# [1.,1.,1.]/np.sqrt(3.)]).transpose()), # direction of blue
|
|
|
|
# 'hexagonal' : np.linalg.inv(np.array([[0.,0.,1.], # direction of red
|
2013-11-26 00:34:39 +05:30
|
|
|
# [1.,0.,0.], # direction of green
|
2015-05-08 19:44:44 +05:30
|
|
|
# [np.sqrt(3.),1.,0.]/np.sqrt(4.)]).transpose()), # direction of blue
|
|
|
|
# 'tetragonal' : np.linalg.inv(np.array([[0.,0.,1.], # direction of red
|
2013-11-26 00:34:39 +05:30
|
|
|
# [1.,0.,0.], # direction of green
|
2015-05-08 19:44:44 +05:30
|
|
|
# [1.,1.,0.]/np.sqrt(2.)]).transpose()), # direction of blue
|
|
|
|
# 'orthorhombic' : np.linalg.inv(np.array([[0.,0.,1.], # direction of red
|
2013-11-26 00:34:39 +05:30
|
|
|
# [1.,0.,0.], # direction of green
|
|
|
|
# [0.,1.,0.]]).transpose()), # direction of blue
|
|
|
|
# }
|
|
|
|
if self.lattice == 'cubic':
|
2015-05-08 19:44:44 +05:30
|
|
|
basis = np.array([ [-1. , 0. , 1. ],
|
|
|
|
[ np.sqrt(2.), -np.sqrt(2.), 0. ],
|
|
|
|
[ 0. , np.sqrt(3.), 0. ] ])
|
2013-11-26 00:34:39 +05:30
|
|
|
elif self.lattice == 'hexagonal':
|
2015-05-08 19:44:44 +05:30
|
|
|
basis = np.array([ [ 0. , 0. , 1. ],
|
|
|
|
[ 1. , -np.sqrt(3.), 0. ],
|
|
|
|
[ 0. , 2. , 0. ] ])
|
2013-11-26 00:34:39 +05:30
|
|
|
elif self.lattice == 'tetragonal':
|
2015-05-08 19:44:44 +05:30
|
|
|
basis = np.array([ [ 0. , 0. , 1. ],
|
|
|
|
[ 1. , -1. , 0. ],
|
|
|
|
[ 0. , np.sqrt(2.), 0. ] ])
|
2013-11-26 00:34:39 +05:30
|
|
|
elif self.lattice == 'orthorhombic':
|
2015-05-08 19:44:44 +05:30
|
|
|
basis = np.array([ [ 0., 0., 1.],
|
|
|
|
[ 1., 0., 0.],
|
|
|
|
[ 0., 1., 0.] ])
|
2013-11-26 00:34:39 +05:30
|
|
|
else:
|
|
|
|
basis = None
|
|
|
|
|
|
|
|
if basis == None:
|
2015-05-08 19:44:44 +05:30
|
|
|
theComponents = -np.ones(3,'d')
|
2013-11-26 00:34:39 +05:30
|
|
|
else:
|
2015-05-08 19:44:44 +05:30
|
|
|
theComponents = np.dot(basis,np.array([vector[0],vector[1],abs(vector[2])]))
|
2015-04-03 00:45:09 +05:30
|
|
|
|
2015-05-08 19:44:44 +05:30
|
|
|
inSST = np.all(theComponents >= 0.0)
|
2013-11-26 00:34:39 +05:30
|
|
|
|
|
|
|
if color: # have to return color array
|
|
|
|
if inSST:
|
2015-05-08 19:44:44 +05:30
|
|
|
rgb = np.power(theComponents/np.linalg.norm(theComponents),0.5) # smoothen color ramps
|
|
|
|
rgb = np.minimum(np.ones(3,'d'),rgb) # limit to maximum intensity
|
2013-11-26 00:34:39 +05:30
|
|
|
rgb /= max(rgb) # normalize to (HS)V = 1
|
|
|
|
else:
|
2015-05-08 19:44:44 +05:30
|
|
|
rgb = np.zeros(3,'d')
|
2013-11-26 00:34:39 +05:30
|
|
|
return (inSST,rgb)
|
|
|
|
else:
|
|
|
|
return inSST
|
|
|
|
|
|
|
|
# code derived from http://pyeuclid.googlecode.com/svn/trunk/euclid.py
|
|
|
|
# suggested reading: http://web.mit.edu/2.998/www/QuaternionReport1.pdf
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
# ******************************************************************************************
|
|
|
|
class Orientation:
|
|
|
|
# ******************************************************************************************
|
|
|
|
|
|
|
|
__slots__ = ['quaternion','symmetry']
|
2015-04-03 00:45:09 +05:30
|
|
|
|
|
|
|
def __init__(self,
|
2013-11-26 00:34:39 +05:30
|
|
|
quaternion = Quaternion.fromIdentity(),
|
|
|
|
Rodrigues = None,
|
|
|
|
angleAxis = None,
|
|
|
|
matrix = None,
|
|
|
|
Eulers = None,
|
|
|
|
random = False,
|
|
|
|
symmetry = None,
|
|
|
|
):
|
|
|
|
if random: # produce random orientation
|
|
|
|
self.quaternion = Quaternion.fromRandom()
|
2015-05-08 19:44:44 +05:30
|
|
|
elif isinstance(Eulers, np.ndarray) and Eulers.shape == (3,): # based on given Euler angles
|
2013-11-26 00:34:39 +05:30
|
|
|
self.quaternion = Quaternion.fromEulers(Eulers,'bunge')
|
2015-05-08 19:44:44 +05:30
|
|
|
elif isinstance(matrix, np.ndarray) and matrix.shape == (3,3): # based on given rotation matrix
|
2013-11-26 00:34:39 +05:30
|
|
|
self.quaternion = Quaternion.fromMatrix(matrix)
|
2015-05-08 19:44:44 +05:30
|
|
|
elif isinstance(angleAxis, np.ndarray) and angleAxis.shape == (4,): # based on given angle and rotation axis
|
2013-11-26 00:34:39 +05:30
|
|
|
self.quaternion = Quaternion.fromAngleAxis(angleAxis[0],angleAxis[1:4])
|
2015-05-08 19:44:44 +05:30
|
|
|
elif isinstance(Rodrigues, np.ndarray) and Rodrigues.shape == (3,): # based on given Rodrigues vector
|
2013-11-26 00:34:39 +05:30
|
|
|
self.quaternion = Quaternion.fromRodrigues(Rodrigues)
|
|
|
|
elif isinstance(quaternion, Quaternion): # based on given quaternion
|
|
|
|
self.quaternion = quaternion.homomorphed()
|
2015-05-08 19:44:44 +05:30
|
|
|
elif isinstance(quaternion, np.ndarray) and quaternion.shape == (4,): # based on given quaternion
|
2013-11-26 00:34:39 +05:30
|
|
|
self.quaternion = Quaternion(quaternion).homomorphed()
|
|
|
|
|
|
|
|
self.symmetry = Symmetry(symmetry)
|
|
|
|
|
|
|
|
def __copy__(self):
|
|
|
|
return self.__class__(quaternion=self.quaternion,symmetry=self.symmetry.lattice)
|
|
|
|
|
|
|
|
copy = __copy__
|
|
|
|
|
|
|
|
|
|
|
|
def __repr__(self):
|
|
|
|
return 'Symmetry: %s\n' % (self.symmetry) + \
|
|
|
|
'Quaternion: %s\n' % (self.quaternion) + \
|
|
|
|
'Matrix:\n%s\n' % ( '\n'.join(['\t'.join(map(str,self.asMatrix()[i,:])) for i in range(3)]) ) + \
|
2015-05-08 19:44:44 +05:30
|
|
|
'Bunge Eulers / deg: %s' % ('\t'.join(map(lambda x:str(np.degrees(x)),self.asEulers('bunge'))) )
|
2013-11-26 00:34:39 +05:30
|
|
|
|
|
|
|
def asQuaternion(self):
|
|
|
|
return self.quaternion.asList()
|
|
|
|
|
|
|
|
|
2015-03-06 19:24:30 +05:30
|
|
|
def asEulers(self,type='bunge'):
|
2013-11-26 00:34:39 +05:30
|
|
|
return self.quaternion.asEulers(type)
|
|
|
|
|
|
|
|
|
|
|
|
def asRodrigues(self):
|
|
|
|
return self.quaternion.asRodrigues()
|
|
|
|
|
|
|
|
|
|
|
|
def asMatrix(self):
|
|
|
|
return self.quaternion.asMatrix()
|
|
|
|
|
|
|
|
|
|
|
|
def reduced(self):
|
|
|
|
'''
|
|
|
|
Transform orientation to fall into fundamental zone according to own (or given) symmetry
|
|
|
|
'''
|
|
|
|
|
|
|
|
for me in self.symmetry.equivalentQuaternions(self.quaternion):
|
|
|
|
if self.symmetry.inFZ(me.asRodrigues()): break
|
|
|
|
|
|
|
|
return Orientation(quaternion=me,symmetry=self.symmetry.lattice)
|
|
|
|
|
|
|
|
|
|
|
|
def disorientation(self,other):
|
|
|
|
'''
|
|
|
|
Disorientation between myself and given other orientation
|
|
|
|
(either reduced according to my own symmetry or given one)
|
|
|
|
'''
|
|
|
|
|
|
|
|
lowerSymmetry = min(self.symmetry,other.symmetry)
|
|
|
|
breaker = False
|
|
|
|
|
|
|
|
for me in self.symmetry.equivalentQuaternions(self.quaternion):
|
|
|
|
me.conjugate()
|
|
|
|
for they in other.symmetry.equivalentQuaternions(other.quaternion):
|
2015-03-06 19:24:30 +05:30
|
|
|
# theQ = me * they
|
|
|
|
theQ = they * me
|
2014-08-22 21:15:03 +05:30
|
|
|
# if theQ.x < 0.0 or theQ.y < 0.0 or theQ.z < 0.0: theQ.conjugate() # speed up scanning since minimum angle is usually found for positive x,y,z
|
2015-03-06 19:24:30 +05:30
|
|
|
breaker = lowerSymmetry.inDisorientationSST(theQ.asRodrigues()) #\
|
|
|
|
# or lowerSymmetry.inDisorientationSST(theQ.conjugated().asRodrigues())
|
2014-08-22 21:15:03 +05:30
|
|
|
if breaker: break
|
2013-11-26 00:34:39 +05:30
|
|
|
if breaker: break
|
2014-08-22 21:15:03 +05:30
|
|
|
|
|
|
|
return Orientation(quaternion=theQ,symmetry=self.symmetry.lattice) #, me.conjugated(), they
|
2013-11-26 00:34:39 +05:30
|
|
|
|
|
|
|
|
2015-03-28 13:13:49 +05:30
|
|
|
def inversePole(self,axis,SST = True):
|
|
|
|
'''
|
|
|
|
axis rotated according to orientation (using crystal symmetry to ensure location falls into SST)
|
|
|
|
'''
|
2015-04-03 00:45:09 +05:30
|
|
|
|
2015-03-30 00:46:45 +05:30
|
|
|
for i,q in enumerate(self.symmetry.equivalentQuaternions(self.quaternion)): # test all symmetric equivalent orientations
|
|
|
|
if SST: # pole requested to be within SST
|
|
|
|
pole = q.conjugated()*axis # align crystal direction to axis
|
|
|
|
if self.symmetry.inSST(pole): break
|
|
|
|
else:
|
|
|
|
pole = q.conjugated()*axis # align crystal direction to axis
|
2015-03-28 13:13:49 +05:30
|
|
|
|
|
|
|
return pole
|
|
|
|
|
2013-11-26 00:34:39 +05:30
|
|
|
def IPFcolor(self,axis):
|
|
|
|
'''
|
|
|
|
TSL color of inverse pole figure for given axis
|
|
|
|
'''
|
|
|
|
|
2015-05-08 19:44:44 +05:30
|
|
|
color = np.zeros(3,'d')
|
2013-11-26 00:34:39 +05:30
|
|
|
|
2013-12-09 21:19:57 +05:30
|
|
|
for i,q in enumerate(self.symmetry.equivalentQuaternions(self.quaternion)):
|
|
|
|
pole = q.conjugated()*axis # align crystal direction to axis
|
2013-11-26 00:34:39 +05:30
|
|
|
inSST,color = self.symmetry.inSST(pole,color=True)
|
|
|
|
if inSST: break
|
|
|
|
|
|
|
|
return color
|
2015-04-03 00:45:09 +05:30
|
|
|
|
|
|
|
@classmethod
|
|
|
|
def getAverageOrientation(cls, orientationList):
|
|
|
|
"""RETURN THE AVERAGE ORIENTATION
|
|
|
|
ref: F. Landis Markley, Yang Cheng, John Lucas Crassidis, and Yaakov Oshman.
|
|
|
|
Averaging Quaternions,
|
|
|
|
Journal of Guidance, Control, and Dynamics, Vol. 30, No. 4 (2007), pp. 1193-1197.
|
|
|
|
doi: 10.2514/1.28949
|
|
|
|
usage:
|
|
|
|
a = Orientation(Eulers=np.radians([10, 10, 0]), symmetry='hexagonal')
|
|
|
|
b = Orientation(Eulers=np.radians([20, 0, 0]), symmetry='hexagonal')
|
|
|
|
avg = Orientation.getAverageOrientation([a,b])"""
|
|
|
|
if not all(isinstance(item, Orientation) for item in orientationList):
|
|
|
|
raise TypeError("Only instances of Orientation can be averaged.")
|
|
|
|
n = len(orientationList)
|
|
|
|
tmp_m = orientationList.pop(0).quaternion.asM()
|
|
|
|
for tmp_o in orientationList:
|
|
|
|
tmp_m += tmp_o.quaternion.asM()
|
2015-05-08 19:44:44 +05:30
|
|
|
eig, vec = np.linalg.eig(tmp_m/n)
|
|
|
|
return Orientation( quaternion=Quaternion(quatArray=vec.T[eig.argmax()]) )
|
|
|
|
|
|
|
|
|
|
|
|
def related(self, relationModel, direction, targetSymmetry):
|
|
|
|
|
|
|
|
if relationModel not in ['KS','GT',"GT'",'NW','Bain']: return None
|
|
|
|
|
|
|
|
variant = int(abs(direction))
|
|
|
|
me = 0 if direction > 0 else 1
|
|
|
|
other = 1 if direction > 0 else 0
|
|
|
|
|
|
|
|
planes = {'KS': \
|
|
|
|
np.array([[[ 1, 1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ 1, 1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ 1, 1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ 1, 1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ 1, 1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ 1, 1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ 1, -1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ 1, -1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ 1, -1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ 1, -1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ 1, -1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ 1, -1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ -1, 1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ -1, 1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ -1, 1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ -1, 1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ -1, 1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ -1, 1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ 1, 1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ 1, 1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ 1, 1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ 1, 1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ 1, 1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ 1, 1, 1],[ 0, 1, 1]]]),
|
|
|
|
'GT': \
|
|
|
|
np.array([[[ 1, 1, 1],[ 1, 1, 0]],\
|
|
|
|
[[ 1, 1, 1],[ 1, 0, 1]],\
|
|
|
|
[[ -1, -1, 1],[ -1, -1, 0]],\
|
|
|
|
[[ -1, -1, 1],[ -1, 0, 1]],\
|
|
|
|
[[ -1, 1, 1],[ -1, 1, 0]],\
|
|
|
|
[[ -1, 1, 1],[ -1, 0, 1]],\
|
|
|
|
[[ 1, -1, 1],[ 1, -1, 0]],\
|
|
|
|
[[ 1, -1, 1],[ 1, 0, 1]],\
|
|
|
|
[[ 1, 1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ 1, 1, 1],[ 1, 1, 0]],\
|
|
|
|
[[ -1, -1, 1],[ 0, -1, 1]],\
|
|
|
|
[[ -1, -1, 1],[ -1, -1, 0]],\
|
|
|
|
[[ -1, 1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ -1, 1, 1],[ -1, 1, 0]],\
|
|
|
|
[[ 1, -1, 1],[ 0, -1, 1]],\
|
|
|
|
[[ 1, -1, 1],[ 1, -1, 0]],\
|
|
|
|
[[ 1, 1, 1],[ 1, 0, 1]],\
|
|
|
|
[[ 1, 1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ -1, -1, 1],[ -1, 0, 1]],\
|
|
|
|
[[ -1, -1, 1],[ 0, -1, 1]],\
|
|
|
|
[[ -1, 1, 1],[ -1, 0, 1]],\
|
|
|
|
[[ -1, 1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ 1, -1, 1],[ 1, 0, 1]],\
|
|
|
|
[[ 1, -1, 1],[ 0, -1, 1]]]),
|
|
|
|
"GT'": \
|
|
|
|
np.array([[[ 17, 7, 17],[ 17, 12, 5]],\
|
|
|
|
[[-17, 7,-17],[-17, 12, -5]],\
|
|
|
|
[[-17, -7, 17],[-17,-12, 5]],\
|
|
|
|
[[ 17, -7,-17],[ 17,-12, -5]],\
|
|
|
|
[[ 17, 17, 7],[ 17, 5, 12]],\
|
|
|
|
[[-17,-17, 7],[-17, -5, 12]],\
|
|
|
|
[[ 17,-17, -7],[ 17, -5,-12]],\
|
|
|
|
[[-17, 17, -7],[-17, 5,-12]],\
|
|
|
|
[[ 17, 17, 7],[ 5, 17, 12]],\
|
|
|
|
[[-17,-17, 7],[ -5,-17, 12]],\
|
|
|
|
[[ 17,-17, -7],[ 5,-17,-12]],\
|
|
|
|
[[-17, 17, -7],[ -5, 17,-12]],\
|
|
|
|
[[ 7, 17, 17],[ 12, 17, 5]],\
|
|
|
|
[[ 7,-17,-17],[ 12,-17, -5]],\
|
|
|
|
[[ -7,-17, 17],[-12,-17, 5]],\
|
|
|
|
[[ -7, 17,-17],[-12, 17, -5]],\
|
|
|
|
[[ 7, 17, 17],[ 12, 5, 17]],\
|
|
|
|
[[ 7,-17,-17],[ 12, -5,-17]],\
|
|
|
|
[[ -7,-17, 17],[-12, -5, 17]],\
|
|
|
|
[[ -7, 17,-17],[-12, 5,-17]],\
|
|
|
|
[[ 17, 7, 17],[ 5, 12, 17]],\
|
|
|
|
[[-17, 7,-17],[ -5, 12,-17]],\
|
|
|
|
[[-17, -7, 17],[ -5,-12, 17]],\
|
|
|
|
[[ 17, -7,-17],[ 5,-12,-17]]]),
|
|
|
|
'NW': \
|
|
|
|
np.array([[[ 1, 1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ 1, 1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ 1, 1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ -1, 1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ -1, 1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ -1, 1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ 1, -1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ 1, -1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ 1, -1, 1],[ 0, 1, 1]],\
|
|
|
|
[[ 1, 1, -1],[ 0, 1, 1]],\
|
|
|
|
[[ 1, 1, -1],[ 0, 1, 1]],\
|
|
|
|
[[ 1, 1, -1],[ 0, 1, 1]]]),
|
|
|
|
'Bain': \
|
|
|
|
np.array([[[ 1, 0, 0],[ 1, 0, 0]],\
|
|
|
|
[[ 0, 1, 0],[ 0, 1, 0]],\
|
|
|
|
[[ 0, 0, 1],[ 0, 0, 1]]]),
|
|
|
|
}
|
|
|
|
|
|
|
|
normals = {'KS': \
|
|
|
|
np.array([[[ -1, 0, 1],[ -1, -1, 1]],\
|
|
|
|
[[ -1, 0, 1],[ -1, 1, -1]],\
|
|
|
|
[[ 0, 1, -1],[ -1, -1, 1]],\
|
|
|
|
[[ 0, 1, -1],[ -1, 1, -1]],\
|
|
|
|
[[ 1, -1, 0],[ -1, -1, 1]],\
|
|
|
|
[[ 1, -1, 0],[ -1, 1, -1]],\
|
|
|
|
[[ -1, 0, 1],[ -1, -1, 1]],\
|
|
|
|
[[ -1, 0, 1],[ -1, 1, -1]],\
|
|
|
|
[[ 0, 1, -1],[ -1, -1, 1]],\
|
|
|
|
[[ 0, 1, -1],[ -1, 1, -1]],\
|
|
|
|
[[ 1, -1, 0],[ -1, -1, 1]],\
|
|
|
|
[[ 1, -1, 0],[ -1, 1, -1]],\
|
|
|
|
[[ -1, 0, 1],[ -1, -1, 1]],\
|
|
|
|
[[ -1, 0, 1],[ -1, 1, -1]],\
|
|
|
|
[[ 0, 1, -1],[ -1, -1, 1]],\
|
|
|
|
[[ 0, 1, -1],[ -1, 1, -1]],\
|
|
|
|
[[ 1, -1, 0],[ -1, -1, 1]],\
|
|
|
|
[[ 1, -1, 0],[ -1, 1, -1]],\
|
|
|
|
[[ -1, 0, 1],[ -1, -1, 1]],\
|
|
|
|
[[ -1, 0, 1],[ -1, 1, -1]],\
|
|
|
|
[[ 0, 1, -1],[ -1, -1, 1]],\
|
|
|
|
[[ 0, 1, -1],[ -1, 1, -1]],\
|
|
|
|
[[ 1, -1, 0],[ -1, -1, 1]],\
|
|
|
|
[[ 1, -1, 0],[ -1, 1, -1]]]),
|
|
|
|
'GT': \
|
|
|
|
np.array([[[ 17, -5,-12],[ 17,-17, -7]],\
|
|
|
|
[[ 17,-12, -5],[ 17, -7,-17]],\
|
|
|
|
[[-17, 5,-12],[-17, 17, -7]],\
|
|
|
|
[[-17, 12, -5],[-17, 7,-17]],\
|
|
|
|
[[ 17, 5, 12],[ 17, 17, 7]],\
|
|
|
|
[[ 17, 12, 5],[ 17, 7, 17]],\
|
|
|
|
[[-17, -5, 12],[-17,-17, 7]],\
|
|
|
|
[[-17,-12, 5],[-17, -7, 17]],\
|
|
|
|
[[-12, 17, -5],[ -7, 17,-17]],\
|
|
|
|
[[ -5, 17,-12],[-17, 17, -7]],\
|
|
|
|
[[ 12,-17, -5],[ 7,-17,-17]],\
|
|
|
|
[[ 5,-17,-12],[ 17,-17, -7]],\
|
|
|
|
[[-12,-17, 5],[ -7,-17, 17]],\
|
|
|
|
[[ -5,-17, 12],[-17,-17, 7]],\
|
|
|
|
[[ 12, 17, 5],[ 7, 17, 17]],\
|
|
|
|
[[ 5, 17, 12],[ 17, 17, 7]],\
|
|
|
|
[[ -5,-12, 17],[-17, -7, 17]],\
|
|
|
|
[[-12, -5, 17],[ -7,-17, 17]],\
|
|
|
|
[[ 5, 12, 17],[ 17, 7, 17]],\
|
|
|
|
[[ 12, 5, 17],[ 7, 17, 17]],\
|
|
|
|
[[ -5, 12,-17],[-17, 7,-17]],\
|
|
|
|
[[-12, 5,-17],[ -7, 17,-17]],\
|
|
|
|
[[ 5,-12,-17],[ 17, -7,-17]],\
|
|
|
|
[[ 12, -5,-17],[ 7,-17,-17]]]),
|
|
|
|
"GT'": \
|
|
|
|
np.array([[[ -1, 0, 1],[ -1, 1, 1]],\
|
|
|
|
[[ -1, 0, 1],[ -1, -1, 1]],\
|
|
|
|
[[ 1, 0, 1],[ 1, -1, 1]],\
|
|
|
|
[[ 1, 0, 1],[ 1, 1, 1]],\
|
|
|
|
[[ -1, 1, 0],[ -1, 1, 1]],\
|
|
|
|
[[ -1, 1, 0],[ -1, 1, -1]],\
|
|
|
|
[[ 1, 1, 0],[ 1, 1, 1]],\
|
|
|
|
[[ 1, 1, 0],[ 1, 1, -1]],\
|
|
|
|
[[ 1, -1, 0],[ 1, -1, 1]],\
|
|
|
|
[[ 1, -1, 0],[ 1, -1, -1]],\
|
|
|
|
[[ -1, -1, 0],[ -1, -1, 1]],\
|
|
|
|
[[ -1, -1, 0],[ -1, -1, -1]],\
|
|
|
|
[[ 0, -1, 1],[ 1, -1, 1]],\
|
|
|
|
[[ 0, -1, 1],[ -1, -1, 1]],\
|
|
|
|
[[ 0, 1, 1],[ -1, 1, 1]],\
|
|
|
|
[[ 0, 1, 1],[ 1, 1, 1]],\
|
|
|
|
[[ 0, 1, -1],[ 1, 1, -1]],\
|
|
|
|
[[ 0, 1, -1],[ -1, 1, -1]],\
|
|
|
|
[[ 0, -1, -1],[ -1, -1, -1]],\
|
|
|
|
[[ 0, -1, -1],[ 1, -1, -1]],\
|
|
|
|
[[ 1, 0, -1],[ 1, 1, -1]],\
|
|
|
|
[[ 1, 0, -1],[ 1, -1, -1]],\
|
|
|
|
[[ -1, 0, -1],[ -1, -1, -1]],\
|
|
|
|
[[ -1, 0, -1],[ -1, 1, -1]]]),
|
|
|
|
'NW': \
|
|
|
|
np.array([[[ 1, -1, 0],[ 1, 0, 0]],\
|
|
|
|
[[ 1, 0, -1],[ 1, 0, 0]],\
|
|
|
|
[[ 0, -1, 1],[ 1, 0, 0]],\
|
|
|
|
[[ 1, 1, 0],[ 1, 0, 0]],\
|
|
|
|
[[ 0, 1, -1],[ 1, 0, 0]],\
|
|
|
|
[[ 1, 0, 1],[ 1, 0, 0]],\
|
|
|
|
[[ 1, 1, 0],[ 1, 0, 0]],\
|
|
|
|
[[ 0, 1, 1],[ 1, 0, 0]],\
|
|
|
|
[[ -1, 0, 1],[ 1, 0, 0]],\
|
|
|
|
[[ 1, 0, 1],[ 1, 0, 0]],\
|
|
|
|
[[ 1, -1, 0],[ 1, 0, 0]],\
|
|
|
|
[[ 0, 1, 1],[ 1, 0, 0]]]),
|
|
|
|
'Bain': \
|
|
|
|
np.array([[[ 0, 1, 0],[ 0, 1, 1]],
|
|
|
|
[[ 0, 0, 1],[ 1, 0, 1]],
|
|
|
|
[[ 1, 0, 0],[ 1, 1, 0]]])]
|
|
|
|
}
|
|
|
|
myMatrix = np.array([[planes [relationModel][variant,me]],\
|
|
|
|
[normals[relationModel][variant,me]],\
|
|
|
|
[np.cross(normals[relationModel][variant,me],planes[relationModel][variant,me])]])
|
|
|
|
otherMatrix = np.array([[planes [relationModel][variant,other]],\
|
|
|
|
[normals[relationModel][variant,other]],\
|
|
|
|
[np.cross(normals[relationModel][variant,other],planes[relationModel][variant,other])]])
|
|
|
|
|
|
|
|
def getRotation(self,variant):
|
|
|
|
fccN=np.array([1.,1.,1.])
|
|
|
|
fccN=fccN/np.linalg.norm(fccN)
|
|
|
|
fccN=self.orientation.asMatrix().dot(fccN)
|
|
|
|
|
|
|
|
fccD=np.array([17.,-5.,-12.])
|
|
|
|
fccD=fccD/np.linalg.norm(fccD)
|
|
|
|
fccD=self.orientation.asMatrix().dot(fccD)
|
|
|
|
|
|
|
|
|
|
|
|
bccN=np.array([1.,1.,0.])
|
|
|
|
bccN=bccN/np.linalg.norm(bccN)
|
|
|
|
bccN=self.orientation.asMatrix().dot(bccN)
|
|
|
|
|
|
|
|
bccD=np.array([17.,-17.,-7.])
|
|
|
|
bccD=bccD/np.linalg.norm(bccD)
|
|
|
|
bccD=self.orientation.asMatrix().dot(bccD)
|
|
|
|
|
|
|
|
B = np.array(np.outer(bccN,fccN.T)+np.outer(bccD,fccD.T))*0.5
|
|
|
|
U,S,VT = np.linalg.svd(B)
|
|
|
|
M=np.diag([1,1,np.linalg.det(U)*np.linalg.det(VT)])
|
|
|
|
R=(U.dot(M)).dot(VT)
|
|
|
|
return Orientation(matrix=R)
|
|
|
|
|
|
|
|
|
|
|
|
|